3-(Perfluorohexyl)propyl iodide - stabilized with copper powder, CAS [[89889-20-3]]
Catalog Number:
CBS-FP80058
| Article Name: |
3-(Perfluorohexyl)propyl iodide - stabilized with copper powder, CAS [[89889-20-3]] |
| Biozol Catalog Number: |
CBS-FP80058 |
| Supplier Catalog Number: |
FP80058 |
| Alternative Catalog Number: |
CBS-FP80058-500MG, CBS-FP80058-1000MG, CBS-FP80058-2000MG, CBS-FP80058-5000MG, CBS-FP80058-10000MG |
| Manufacturer: |
Biosynth |
| Category: |
Biochemikalien |
| Alternative Names: |
1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-9-iodononane |
| Molecular Weight: |
488.03 g/mol |
| Sequence: |
FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCCI |
| CAS Number: |
[89889-20-3] |
| Formula: |
C9H6F13I |